EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O6S |
| Net Charge | 0 |
| Average Mass | 379.414 |
| Monoisotopic Mass | 379.09638 |
| SMILES | *C(=O)[C@@H](NC(=O)C(C(=O)O)c1ccccc1)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbenicilloyl group (CHEBI:55468) has role antibacterial agent (CHEBI:33282) |
| carbenicilloyl group (CHEBI:55468) is a organyl group (CHEBI:33249) |
| carbenicilloyl group (CHEBI:55468) is substituent group from carbenicillin (CHEBI:3393) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,4S)-4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl]-2-{[carboxy(phenyl)acetyl]amino}acetyl |
| Synonym | Source |
|---|---|
| carbenicilloyl | ChEBI |
| Citations |
|---|