EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O3 |
| Net Charge | 0 |
| Average Mass | 168.192 |
| Monoisotopic Mass | 168.07864 |
| SMILES | CC12CCCCC1C(=O)OC2=O |
| InChI | InChI=1S/C9H12O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h6H,2-5H2,1H3 |
| InChIKey | VYKXQOYUCMREIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | curing agent A chemical additive used to toughen or harden a polymer material by cross-linking of polymer chains. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylhexahydrophthalic anhydride (CHEBI:55461) has role allergen (CHEBI:50904) |
| methylhexahydrophthalic anhydride (CHEBI:55461) has role curing agent (CHEBI:75358) |
| methylhexahydrophthalic anhydride (CHEBI:55461) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| methylhexahydrophthalic anhydride (CHEBI:55461) is a tetrahydrofurandione (CHEBI:47022) |
| IUPAC Name |
|---|
| 3a-methylhexahydro-2-benzofuran-1,3-dione |
| Synonyms | Source |
|---|---|
| hexahydromethyl-1,3-isobenzofurandione | ChemIDplus |
| methyl-1,2-cyclohexanedicarboxylic anhydride | ChemIDplus |
| MHHPA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| JP2004010535 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:147628 | Reaxys |
| CAS:25550-51-0 | ChemIDplus |
| Citations |
|---|