EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O7S2 |
| Net Charge | 0 |
| Average Mass | 415.469 |
| Monoisotopic Mass | 415.06337 |
| SMILES | *C(=O)[C@@H](NC(=O)C(c1ccccc1)S(=O)(=O)O)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulbenicilloyl group (CHEBI:55459) has role antibacterial agent (CHEBI:33282) |
| sulbenicilloyl group (CHEBI:55459) is a organyl group (CHEBI:33249) |
| sulbenicilloyl group (CHEBI:55459) is a penicilloyl group allergen (CHEBI:88223) |
| sulbenicilloyl group (CHEBI:55459) is substituent group from sulbenicillin (CHEBI:9322) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,4S)-4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl]-2-{[phenyl(sulfo)acetyl]amino}acetyl |
| Synonyms | Source |
|---|---|
| SBPO | ChEBI |
| sulbenicilloyl | ChEBI |
| Citations |
|---|