EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:55443 - N-(p-hydroxyphenyl)glycine
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | O=C(O)CNc1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3/c10-7-3-1-6(2-4-7)9-5-8(11)12/h1-4,9-10H,5H2,(H,11,12) |
| InChIKey | WRUZLCLJULHLEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(p-hydroxyphenyl)glycine (CHEBI:55443) has role allergen (CHEBI:50904) |
| N-(p-hydroxyphenyl)glycine (CHEBI:55443) is a glycine derivative (CHEBI:24373) |
| N-(p-hydroxyphenyl)glycine (CHEBI:55443) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| N-(p-hydroxyphenyl)glycine (CHEBI:55443) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-(4-hydroxyphenyl)glycine |
| Synonyms | Source |
|---|---|
| 4-(Carboxymethylamino)phenol | ChemIDplus |
| Hydroxyphenyl glycine | ChemIDplus |
| Photoglycine | ChemIDplus |
| p-Hydroxyanilinoacetic acid | ChemIDplus |
| p-Hydroxyphenyl glycine | ChemIDplus |
| p-Hydroxyphenylaminoacetic acid | ChemIDplus |
| Citations |
|---|