EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N5O5 |
| Net Charge | 0 |
| Average Mass | 289.292 |
| Monoisotopic Mass | 289.13862 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N5O5/c11-5(8(17)18)4-7(16)15-6(9(19)20)2-1-3-14-10(12)13/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H4,12,13,14)/t5-,6-/m0/s1 |
| InChIKey | QCGCETFHYOEVAI-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-Asp-Arg (CHEBI:55435) is a dipeptide (CHEBI:46761) |
| β-Asp-Arg (CHEBI:55435) is tautomer of β-Asp-Arg zwitterion (CHEBI:137991) |
| Incoming Relation(s) |
| β-Asp-Arg zwitterion (CHEBI:137991) is tautomer of β-Asp-Arg (CHEBI:55435) |
| IUPAC Name |
|---|
| L-β-aspartyl-L-arginine |
| Synonyms | Source |
|---|---|
| β-aspartylarginine | ChEBI |
| β-L-Asp-L-Arg | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2510818 | Beilstein |