EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 359.401 |
| Monoisotopic Mass | 359.16452 |
| SMILES | Cc1c(F)c(N2CCNC(C)C2)cc2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C19H22FN3O3/c1-10-8-22(6-5-21-10)15-7-14-16(11(2)17(15)20)18(24)13(19(25)26)9-23(14)12-3-4-12/h7,9-10,12,21H,3-6,8H2,1-2H3,(H,25,26) |
| InChIKey | AIJTTZAVMXIJGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Grepafloxacin (CHEBI:5543) is a fluoroquinolone antibiotic (CHEBI:87211) |
| Grepafloxacin (CHEBI:5543) is a quinolines (CHEBI:26513) |
| Grepafloxacin (CHEBI:5543) is a quinolone antibiotic (CHEBI:86324) |
| Synonyms | Source |
|---|---|
| Grepafloxacin | KEGG COMPOUND |
| grepafloxacin HCl | DrugCentral |
| grepafloxacin hydrochloride | DrugCentral |
| grepafloxacin hydrochloride hydrate | DrugCentral |
| tomefloxacin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| C11368 | KEGG COMPOUND |
| 1330 | DrugCentral |
| HMDB0014509 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:119914-60-2 | KEGG COMPOUND |