EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O4S |
| Net Charge | 0 |
| Average Mass | 232.301 |
| Monoisotopic Mass | 232.07693 |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2 |
| InChI | InChI=1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-camphorsulfonic acid (CHEBI:55403) is a camphorsulfonic acid (CHEBI:55379) |
| (S)-camphorsulfonic acid (CHEBI:55403) is conjugate acid of (S)-camphorsulfonate (CHEBI:55408) |
| (S)-camphorsulfonic acid (CHEBI:55403) is enantiomer of (R)-camphorsulfonic acid (CHEBI:55401) |
| Incoming Relation(s) |
| (S)-camphorsulfonate (CHEBI:55408) is conjugate base of (S)-camphorsulfonic acid (CHEBI:55403) |
| (R)-camphorsulfonic acid (CHEBI:55401) is enantiomer of (S)-camphorsulfonic acid (CHEBI:55403) |
| IUPAC Name |
|---|
| [(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid |
| Synonyms | Source |
|---|---|
| (1S)-(+)-10-camphorsulfonic acid | ChEBI |
| (1S)-10-camphorsulfonic acid | ChEBI |
| (1S,4R)-(+)-2-oxo-10-bornanesulfonic acid | ChemIDplus |
| (1S)-(+)-CSA | ChEBI |
| Camphersulfosäure | ChemIDplus |
| d-Camphorsulfonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2809675 | Reaxys |
| CAS:3144-16-9 | ChemIDplus |