EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)C(=O)C[C@]1(C)[C@@]([H])([C@]3(C)CC[C@@H](C(C)(C)O)O3)CC[C@@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)18-9-11-21-27(5)15-13-20(29(7)16-14-24(34-29)26(3,4)33)28(27,6)17-23(32)30(21,8)19(18)10-12-22(25)31/h9,19-22,24,31,33H,10-17H2,1-8H3/t19-,20+,21+,22+,24+,27+,28-,29+,30+/m1/s1 |
| InChIKey | DJFUSGZOFOKWFY-HVNJZMCDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gratiogenin (CHEBI:5540) is a triterpenoid saponin (CHEBI:61778) |
| Synonym | Source |
|---|---|
| Gratiogenin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08808 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:7067-16-5 | KEGG COMPOUND |