EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O6P |
| Net Charge | +1 |
| Average Mass | 305.247 |
| Monoisotopic Mass | 305.08970 |
| SMILES | C[N+](C)(C)CCOP(=O)(O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H17N2O6P/c1-13(2,3)8-9-18-20(16,17)19-11-6-4-10(5-7-11)12(14)15/h4-7H,8-9H2,1-3H3/p+1 |
| InChIKey | NAIXASFEPQPICN-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-nitrophenylphosphocholine (CHEBI:55394) has role epitope (CHEBI:53000) |
| p-nitrophenylphosphocholine (CHEBI:55394) has role hapten (CHEBI:59174) |
| p-nitrophenylphosphocholine (CHEBI:55394) is a phosphocholines (CHEBI:36700) |
| IUPAC Names |
|---|
| 2-{[hydroxy(4-nitrophenoxy)phosphoryl]oxy}-N,N,N-trimethylethanaminium |
| 4-nitrophenyl 2-(trimethylammonio)ethyl phosphate |
| Synonyms | Source |
|---|---|
| 4-nitrophenylphosphorylcholine | ChEBI |
| O-(4-nitrophenylphosphoryl)choline | ChEBI |
| p-nitrophenyl phosphorylcholine | ChEBI |
| p-nitrophenylphosphorylcholine | ChEBI |
| nitrophenylphosphocholine | ChEBI |
| nitrophenylphosphorylcholine | ChEBI |
| Citations |
|---|