EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N4O |
| Net Charge | 0 |
| Average Mass | 312.417 |
| Monoisotopic Mass | 312.19501 |
| SMILES | CN1[C@@H]2CCC[C@H]1C[C@@H](NC(=O)c1nn(C)c3ccccc13)C2 |
| InChI | InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14- |
| InChIKey | MFWNKCLOYSRHCJ-BTTYYORXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| granisetron (CHEBI:5537) has role antiemetic (CHEBI:50919) |
| granisetron (CHEBI:5537) has role serotonergic antagonist (CHEBI:48279) |
| granisetron (CHEBI:5537) is a indazoles (CHEBI:38769) |
| granisetron (CHEBI:5537) is a monocarboxylic acid amide (CHEBI:29347) |
| granisetron (CHEBI:5537) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide |
| INNs | Source |
|---|---|
| granisetron | WHO MedNet |
| granisetrón | WHO MedNet |
| granisétron | WHO MedNet |
| granisetronum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide | ChemIDplus |
| APF 530 | ChemIDplus |
| APF530 | ChemIDplus |
| BRL 43694 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Kevatril | ChemIDplus |
| Sancuso | ChemIDplus |
| Sancuso | KEGG DRUG |
| Sustol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1329 | DrugCentral |
| C07023 | KEGG COMPOUND |
| CWB | PDBeChem |
| D04370 | KEGG DRUG |
| DB00889 | DrugBank |
| EP200444 | Patent |
| Granisetron | Wikipedia |
| HMDB0015026 | HMDB |
| US4886808 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3655275 | Reaxys |
| CAS:109889-09-0 | ChemIDplus |
| CAS:109889-09-0 | KEGG COMPOUND |
| Citations |
|---|