EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N4O |
| Net Charge | 0 |
| Average Mass | 312.417 |
| Monoisotopic Mass | 312.19501 |
| SMILES | CN1[C@@H]2CCC[C@H]1C[C@@H](NC(=O)c1nn(C)c3ccccc13)C2 |
| InChI | InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14- |
| InChIKey | MFWNKCLOYSRHCJ-BTTYYORXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| granisetron (CHEBI:5537) has role antiemetic (CHEBI:50919) |
| granisetron (CHEBI:5537) has role serotonergic antagonist (CHEBI:48279) |
| granisetron (CHEBI:5537) is a indazoles (CHEBI:38769) |
| granisetron (CHEBI:5537) is a monocarboxylic acid amide (CHEBI:29347) |
| granisetron (CHEBI:5537) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide |
| INNs | Source |
|---|---|
| granisetron | WHO MedNet |
| granisetrón | WHO MedNet |
| granisétron | WHO MedNet |
| granisetronum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide | ChemIDplus |
| APF 530 | ChemIDplus |
| APF530 | ChemIDplus |
| BRL 43694 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Kevatril | ChemIDplus |
| Sancuso | ChemIDplus |
| Sancuso | KEGG DRUG |
| Sustol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1329 | DrugCentral |
| C07023 | KEGG COMPOUND |
| CWB | PDBeChem |
| D04370 | KEGG DRUG |
| DB00889 | DrugBank |
| EP200444 | Patent |
| Granisetron | Wikipedia |
| HMDB0015026 | HMDB |
| US4886808 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3655275 | Reaxys |
| CAS:109889-09-0 | ChemIDplus |
| CAS:109889-09-0 | KEGG COMPOUND |
| Citations |
|---|