EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11Cl2N.HCl |
| Net Charge | 0 |
| Average Mass | 192.517 |
| Monoisotopic Mass | 191.00353 |
| SMILES | CN(CCCl)CCCl.Cl |
| InChI | InChI=1S/C5H11Cl2N.ClH/c1-8(4-2-6)5-3-7;/h2-5H2,1H3;1H |
| InChIKey | QZIQJVCYUQZDIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mechlorethamine hydrochloride (CHEBI:55368) has part mechlorethamine (CHEBI:28925) |
| mechlorethamine hydrochloride (CHEBI:55368) has role antineoplastic agent (CHEBI:35610) |
| mechlorethamine hydrochloride (CHEBI:55368) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 1,5-Dichloro-3-methyl-3-azapentane hydrochloride | ChemIDplus |
| 2,2'-Dichloro-N-methyldiethylamine hydrochloride | ChemIDplus |
| 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride | ChemIDplus |
| beta,beta'-Dichlorodiethyl-N-methylamine hydrochloride | ChemIDplus |
| Bis(2-chloroethyl)methylamine hydrochloride | ChemIDplus |
| Chloramin | ChemIDplus |
| Citations |
|---|