EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O6 |
| Net Charge | 0 |
| Average Mass | 188.135 |
| Monoisotopic Mass | 188.03209 |
| SMILES | C/C(C(=O)O)=C(/CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O6/c1-3(6(10)11)4(7(12)13)2-5(8)9/h2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/b4-3+ |
| InChIKey | NUZLRKBHOBPTQV-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-but-2-ene-1,2,3-tricarboxylic acid (CHEBI:55353) is a tricarboxylic acid (CHEBI:27093) |
| (2E)-but-2-ene-1,2,3-tricarboxylic acid (CHEBI:55353) is conjugate acid of (2E)-but-2-ene-1,2,3-tricarboxylate (CHEBI:58915) |
| Incoming Relation(s) |
| (2E)-but-2-ene-1,2,3-tricarboxylate (CHEBI:58915) is conjugate base of (2E)-but-2-ene-1,2,3-tricarboxylic acid (CHEBI:55353) |
| IUPAC Name |
|---|
| (2E)-but-2-ene-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-trans-aconitic acid | SUBMITTER |
| trans-2-methylaconitic acid | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2416239 | Beilstein |
| Citations |
|---|