EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O10 |
| Net Charge | 0 |
| Average Mass | 444.392 |
| Monoisotopic Mass | 444.10565 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@](O)(c3c(O)c4c(c(O)c31)C(=O)C1=C(C4=O)C(C)O[C@@]3([H])CC(=O)O[C@@]13[H])[C@@H](C)O2 |
| InChI | InChI=1S/C22H20O10/c1-5-11-15(21-8(30-5)4-10(24)32-21)19(27)13-14(17(11)25)20(28)16-12(18(13)26)7-3-9(23)22(16,29)6(2)31-7/h5-9,21,23,26,28-29H,3-4H2,1-2H3/t5?,6-,7-,8+,9-,21-,22-/m1/s1 |
| InChIKey | QBQXQYSJPWXZJL-NWVAQQJZSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| granaticin (CHEBI:5533) has role antineoplastic agent (CHEBI:35610) |
| granaticin (CHEBI:5533) has role metabolite (CHEBI:25212) |
| granaticin (CHEBI:5533) is a p-quinones (CHEBI:25830) |
| granaticin (CHEBI:5533) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (3aS,8S,9R,13bS,15R)-7,8,12,15-tetrahydroxy-5,9-dimethyl-3,3a,5,8,11,13b-hexahydro-8,11-ethanofuro[3,2-b]pyrano[4',3':6,7]naphtho[2,3-d]pyran-2,6,13(9H)-trione |
| Synonyms | Source |
|---|---|
| (1R,7S,11S,19S,20R,23R)-3,17,19,23-tetrahydroxy-13,20-dimethyl-8,12,21-trioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),3,6(14),16-tetraene-5,9,15-trione | IUPAC |
| Granaticin | KEGG COMPOUND |
| Granaticin A | ChemIDplus |
| Granatomycin C | ChEBI |
| Litmomycin | ChemIDplus |
| Litomycin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| granaticin | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:19879-06-2 | KEGG COMPOUND |
| CAS:19879-06-2 | ChemIDplus |