EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11NO |
| Net Charge | 0 |
| Average Mass | 209.248 |
| Monoisotopic Mass | 209.08406 |
| SMILES | O=C=Nc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11NO/c16-11-15-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | AGAYZDNGCFSGLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylmethane monoisocyanate (CHEBI:55312) has role allergen (CHEBI:50904) |
| diphenylmethane monoisocyanate (CHEBI:55312) is a isocyanates (CHEBI:53212) |
| IUPAC Name |
|---|
| 1-benzyl-4-isocyanatobenzene |
| Synonyms | Source |
|---|---|
| alpha-Phenyl-p-tolyl isocyanate | ChemIDplus |
| MMI | ChEBI |
| 4-isocyanato-4'-diphenylmethane | ChEBI |
| 4-isocyanatodiphenylmethane | ChEBI |
| IDM | ChEBI |
| Isocyanic acid, alpha-phenyl-p-tolyl ester | ChemIDplus |
| Citations |
|---|