EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H75N17O13 |
| Net Charge | 0 |
| Average Mass | 1182.311 |
| Monoisotopic Mass | 1181.57303 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O |
| InChI | InChI=1S/C55H75N17O13/c1-29(2)19-38(49(80)67-37(9-5-17-60-55(57)58)54(85)72-18-6-10-43(72)53(84)62-25-44(56)75)66-46(77)26-63-47(78)39(20-30-11-13-33(74)14-12-30)68-52(83)42(27-73)71-50(81)40(21-31-23-61-35-8-4-3-7-34(31)35)69-51(82)41(22-32-24-59-28-64-32)70-48(79)36-15-16-45(76)65-36/h3-4,7-8,11-14,23-24,28-29,36-43,61,73-74H,5-6,9-10,15-22,25-27H2,1-2H3,(H2,56,75)(H,59,64)(H,62,84)(H,63,78)(H,65,76)(H,66,77)(H,67,80)(H,68,83)(H,69,82)(H,70,79)(H,71,81)(H4,57,58,60)/t36-,37-,38-,39-,40-,41-,42-,43-/m0/s1 |
| InChIKey | XLXSAKCOAKORKW-AQJXLSMYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gonadorelin (CHEBI:5520) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| gonadorelin (CHEBI:5520) is a oligopeptide (CHEBI:25676) |
| gonadorelin (CHEBI:5520) is a peptide hormone (CHEBI:25905) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosylglycyl-L-leucyl-L-arginyl-L-prolylglycinamide |
| INNs | Source |
|---|---|
| gonadorelin | KEGG DRUG |
| gonadorelina | DrugBank |
| gonadorelinum | DrugBank |
| Synonyms | Source |
|---|---|
| 5-oxo-PHWSYGLRPGNH2 | ChEBI |
| Follicle-stimulating hormone-releasing factor | ChemIDplus |
| GnRH-I | KEGG COMPOUND |
| Gonadoliberin I | KEGG COMPOUND |
| Gonadorelin | KEGG COMPOUND |
| Gonadotropin-releasing factor | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2958 | DrugCentral |
| C07607 | KEGG COMPOUND |
| D08027 | KEGG DRUG |
| DB00644 | DrugBank |
| Gonadorelin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:741807 | Reaxys |
| CAS:33515-09-2 | KEGG COMPOUND |
| CAS:33515-09-2 | ChemIDplus |
| Citations |
|---|