EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H75N17O13 |
| Net Charge | 0 |
| Average Mass | 1182.311 |
| Monoisotopic Mass | 1181.57303 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O |
| InChI | InChI=1S/C55H75N17O13/c1-29(2)19-38(49(80)67-37(9-5-17-60-55(57)58)54(85)72-18-6-10-43(72)53(84)62-25-44(56)75)66-46(77)26-63-47(78)39(20-30-11-13-33(74)14-12-30)68-52(83)42(27-73)71-50(81)40(21-31-23-61-35-8-4-3-7-34(31)35)69-51(82)41(22-32-24-59-28-64-32)70-48(79)36-15-16-45(76)65-36/h3-4,7-8,11-14,23-24,28-29,36-43,61,73-74H,5-6,9-10,15-22,25-27H2,1-2H3,(H2,56,75)(H,59,64)(H,62,84)(H,63,78)(H,65,76)(H,66,77)(H,67,80)(H,68,83)(H,69,82)(H,70,79)(H,71,81)(H4,57,58,60)/t36-,37-,38-,39-,40-,41-,42-,43-/m0/s1 |
| InChIKey | XLXSAKCOAKORKW-AQJXLSMYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gonadorelin (CHEBI:5520) has role antineoplastic agent (CHEBI:35610) |
| gonadorelin (CHEBI:5520) has role bone density conservation agent (CHEBI:50646) |
| gonadorelin (CHEBI:5520) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| gonadorelin (CHEBI:5520) is a oligopeptide (CHEBI:25676) |
| gonadorelin (CHEBI:5520) is a peptide hormone (CHEBI:25905) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosylglycyl-L-leucyl-L-arginyl-L-prolylglycinamide |
| INNs | Source |
|---|---|
| gonadorelin | KEGG DRUG |
| gonadorelina | DrugBank |
| gonadoreline | WHO MedNet |
| gonadorelinum | DrugBank |
| Synonyms | Source |
|---|---|
| 5-oxo-PHWSYGLRPGNH2 | ChEBI |
| Follicle-stimulating hormone-releasing factor | ChemIDplus |
| GnRH-I | KEGG COMPOUND |
| Gonadoliberin I | KEGG COMPOUND |
| Gonadorelin | KEGG COMPOUND |
| Gonadorelin decapeptide | ChEMBL |
| Brand Names | Source |
|---|---|
| Fertiral lh-rh | ChEMBL |
| Relefact lh-rh | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2958 | DrugCentral |
| C07607 | KEGG COMPOUND |
| D08027 | KEGG DRUG |
| DB00644 | DrugBank |
| Gonadorelin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:741807 | Reaxys |
| CAS:33515-09-2 | KEGG COMPOUND |
| CAS:33515-09-2 | ChemIDplus |
| Citations |
|---|