EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22O6 |
| Net Charge | 0 |
| Average Mass | 454.478 |
| Monoisotopic Mass | 454.14164 |
| SMILES | O=C1C=C(/C=C/c2ccc(O)cc2)[C@@H]2C(=O)[C@H]1[C@H](c1ccc(O)cc1)[C@H]2c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C28H22O6/c29-19-7-2-15(3-8-19)1-4-17-13-23(33)27-24(16-5-9-20(30)10-6-16)25(26(17)28(27)34)18-11-21(31)14-22(32)12-18/h1-14,24-27,29-32H/b4-1+/t24-,25-,26+,27-/m1/s1 |
| InChIKey | SVSWTEAHRCVGAR-XJAAUWFPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gnetin A (CHEBI:5511) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| Gnetin A | KEGG COMPOUND |