EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | O=C(O)/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H20O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h7,9H,1-6,8,10H2,(H,13,14)(H,15,16)/b9-7+ |
| InChIKey | MAZWDMBCPDUFDJ-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| traumatic acid (CHEBI:545687) has role plant hormone (CHEBI:37848) |
| traumatic acid (CHEBI:545687) is a dicarboxylic acid (CHEBI:35692) |
| Incoming Relation(s) |
| trans-2-dodecenedioyl-CoA (CHEBI:76427) has functional parent traumatic acid (CHEBI:545687) |
| IUPAC Name |
|---|
| (2E)-dodec-2-enedioic acid |
| Synonyms | Source |
|---|---|
| Dodec-2-enedioic acid | ChemIDplus |
| trans-2-dodecenedioic acid | LIPID MAPS |
| 2E-dodecenedioic acid | LIPID MAPS |
| (2E)-Dodecenedioic acid | KEGG COMPOUND |
| Dodec-2-enedioic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| LMFA01170002 | LIPID MAPS |
| C16308 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725762 | Beilstein |
| CAS:6402-36-4 | ChemIDplus |
| CAS:6402-36-4 | KEGG COMPOUND |
| Citations |
|---|