EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18NO9S2 |
| Net Charge | -1 |
| Average Mass | 360.386 |
| Monoisotopic Mass | 360.04285 |
| SMILES | CC(C)/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H19NO9S2/c1-4(2)9(11-20-22(16,17)18)21-10-8(15)7(14)6(13)5(3-12)19-10/h4-8,10,12-15H,3H2,1-2H3,(H,16,17,18)/p-1/b11-9-/t5-,6-,7+,8-,10+/m1/s1 |
| InChIKey | WGIQZGDVCQDPTG-WUBUQRIPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sisymbrium officinale (ncbitaxon:203582) | - | PubMed (23193942) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoputranjivin(1−) (CHEBI:5414) is a alkylglucosinolate (CHEBI:36445) |
| glucoputranjivin(1−) (CHEBI:5414) is conjugate base of glucoputranjivin (CHEBI:79331) |
| Incoming Relation(s) |
| glucoputranjivin (CHEBI:79331) is conjugate acid of glucoputranjivin(1−) (CHEBI:5414) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-2-methyl-N-(sulfonatooxy)propanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-methylethylglucosinolate | ChEBI |
| Glucoputranjivin | KEGG COMPOUND |
| isopropylglucosinolate | ChEBI |
| propan-2-ylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08418 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3706093 | Reaxys |
| CAS:18432-16-1 | KEGG COMPOUND |