EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20NO9S2 |
| Net Charge | -1 |
| Average Mass | 422.457 |
| Monoisotopic Mass | 422.05850 |
| SMILES | O=S(=O)([O-])O/N=C(/CCc1ccccc1)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21NO9S2/c17-8-10-12(18)13(19)14(20)15(24-10)26-11(16-25-27(21,22)23)7-6-9-4-2-1-3-5-9/h1-5,10,12-15,17-20H,6-8H2,(H,21,22,23)/p-1/b16-11-/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | CKIJIGYDFNXSET-OOMJLXHVSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica oleracea var. italica (ncbitaxon:36774) | - | PubMed (23513733) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gluconasturtiin(1−) (CHEBI:5413) is a aralkylglucosinolate (CHEBI:36452) |
| gluconasturtiin(1−) (CHEBI:5413) is conjugate base of gluconasturtiin (CHEBI:79347) |
| Incoming Relation(s) |
| gluconasturtiin (CHEBI:79347) is conjugate acid of gluconasturtiin(1−) (CHEBI:5413) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-3-phenyl-N-(sulfonatooxy)propanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Gluconasturtiin | KEGG COMPOUND |
| 2-phenylethylglucosinolate | ChEBI |
| phenethylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08417 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3746836 | Reaxys |
| CAS:499-30-9 | KEGG COMPOUND |