EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO9S2 |
| Net Charge | -1 |
| Average Mass | 372.397 |
| Monoisotopic Mass | 372.04285 |
| SMILES | C=CCC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO9S2/c1-2-3-4-7(12-21-23(17,18)19)22-11-10(16)9(15)8(14)6(5-13)20-11/h2,6,8-11,13-16H,1,3-5H2,(H,17,18,19)/p-1/b12-7-/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | PLYQBXHVYUJNQB-IIPHORNXSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica rapa (ncbitaxon:3711) | - | PubMed (23001436) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gluconapin(1−) (CHEBI:5411) is a alkenylglucosinolate (CHEBI:36451) |
| gluconapin(1−) (CHEBI:5411) is conjugate base of gluconapin (CHEBI:79319) |
| Incoming Relation(s) |
| glucoraphenin(1−) (CHEBI:5416) has functional parent gluconapin(1−) (CHEBI:5411) |
| ξ-progoitrin(1−) (CHEBI:47798) has functional parent gluconapin(1−) (CHEBI:5411) |
| gluconapin (CHEBI:79319) is conjugate acid of gluconapin(1−) (CHEBI:5411) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfonatooxy)pent-4-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Gluconapin | KEGG COMPOUND |
| but-3-enylglucosinolate | ChEBI |
| 3-butenylglucosinolate | ChEBI |
| UniProt Name | Source |
|---|---|
| gluconapin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08415 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:19041-09-9 | KEGG COMPOUND |