EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])CC[C@@]1(C)[C@H](O)CCC(=C)[C@]21[H] |
| InChI | InChI=1S/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h10-13,16H,1-2,4-7H2,3H3/t10-,11+,12+,13-,15-/m0/s1 |
| InChIKey | FKBUODICGDOIGB-PFFFPCNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Magnolia grandiflora (ncbitaxon:3406) | - | PubMed (9690347) | |
| Ambrosia confertiflora (IPNI:11051-2) | - | PubMed (9690347) | |
| Saussurea lappa (ncbitaxon:324593) | - | PubMed (9690347) | |
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | DOI (10.1016/j.foodchem.2004.10.029) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reynosin (CHEBI:540787) has role metabolite (CHEBI:25212) |
| reynosin (CHEBI:540787) is a organic heterotricyclic compound (CHEBI:26979) |
| reynosin (CHEBI:540787) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3,9-bis(methylene)decahydronaphtho[1,2-b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| (+)-reynosin | ChEBI |
| (3aS,9aβ,9bα)-3a,4,5,5a,6,7,8,9,9a,9b-decahydro-6α-hydroxy-5aα-methyl-3,9-bis(methylene)naphtho[1,2-b]furan-2(3H)-one | ChEBI |
| (3aS)-3a,4,5,5a,6,7,8,9,9aβ,9bα-decahydro-6α-hydroxy-5aα-methyl-3,9-bis(methylene)naphtho[1,2-b]furan-2(3H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1621245 | Reaxys |
| CAS:28254-53-7 | ChemIDplus |
| Citations |
|---|