EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N5O4S |
| Net Charge | 0 |
| Average Mass | 445.545 |
| Monoisotopic Mass | 445.17838 |
| SMILES | Cc1cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCCCC3)cc2)cn1 |
| InChI | InChI=1S/C21H27N5O4S/c1-15-13-24-19(14-23-15)20(27)22-12-11-16-7-9-18(10-8-16)31(29,30)26-21(28)25-17-5-3-2-4-6-17/h7-10,13-14,17H,2-6,11-12H2,1H3,(H,22,27)(H2,25,26,28) |
| InChIKey | ZJJXGWJIGJFDTL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glipizide (CHEBI:5384) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| glipizide (CHEBI:5384) has role hypoglycemic agent (CHEBI:35526) |
| glipizide (CHEBI:5384) has role insulin secretagogue (CHEBI:90415) |
| glipizide (CHEBI:5384) is a N-sulfonylurea (CHEBI:76983) |
| glipizide (CHEBI:5384) is a aromatic amide (CHEBI:62733) |
| glipizide (CHEBI:5384) is a monocarboxylic acid amide (CHEBI:29347) |
| glipizide (CHEBI:5384) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| N-(2-{4-[(cyclohexylcarbamoyl)sulfamoyl]phenyl}ethyl)-5-methylpyrazine-2-carboxamide |
| INNs | Source |
|---|---|
| glipizide | WHO MedNet |
| glipizide | WHO MedNet |
| glipizidum | WHO MedNet |
| glipizida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-cyclohexyl-3-({p-[2-(5-methylpyrazinecarboxamido)ethyl]phenyl}sulfonyl)urea | ChemIDplus |
| CP 28720 | ChemIDplus |
| N-{4-[β-(5-methylpyrazine-2-carboxamido)ethyl]benzenesulphonyl}-N'-cyclohexylurea | ChemIDplus |
| K 4024 | ChemIDplus |
| CP-28,720 | ChemIDplus |
| CP 28,720 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Minidab | ChemIDplus |
| Minodiab | ChemIDplus |
| Glipid | ChemIDplus |
| Glibenese | ChemIDplus |
| Gluco-Rite | ChemIDplus |
| Minidiab | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:903495 | Reaxys |
| CAS:29094-61-9 | ChemIDplus |
| Citations |
|---|