EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5383 - glimepiride
| Formula | C24H34N4O5S |
| Net Charge | 0 |
| Average Mass | 490.626 |
| Monoisotopic Mass | 490.22499 |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@H]3CC[C@H](C)CC3)cc2)C1=O |
| InChI | InChI=1S/C24H34N4O5S/c1-4-21-17(3)15-28(22(21)29)24(31)25-14-13-18-7-11-20(12-8-18)34(32,33)27-23(30)26-19-9-5-16(2)6-10-19/h7-8,11-12,16,19H,4-6,9-10,13-15H2,1-3H3,(H,25,31)(H2,26,27,30)/t16-,19- |
| InChIKey | WIGIZIANZCJQQY-RUCARUNLSA-N |
| Roles Classification |
|---|
| Biological Role: | insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glimepiride (CHEBI:5383) has role antiatherosclerotic agent (CHEBI:145947) |
| glimepiride (CHEBI:5383) has role antihypertensive agent (CHEBI:35674) |
| glimepiride (CHEBI:5383) has role cardiovascular drug (CHEBI:35554) |
| glimepiride (CHEBI:5383) has role hypoglycemic agent (CHEBI:35526) |
| glimepiride (CHEBI:5383) has role insulin secretagogue (CHEBI:90415) |
| glimepiride (CHEBI:5383) is a N-acylurea (CHEBI:74266) |
| glimepiride (CHEBI:5383) is a N-sulfonylurea (CHEBI:76983) |
| glimepiride (CHEBI:5383) is a organic molecular entity (CHEBI:50860) |
| glimepiride (CHEBI:5383) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-ethyl-4-methyl-N-[2-(4-{[(trans-4-methylcyclohexyl)carbamoyl]sulfamoyl}phenyl)ethyl]-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxamide |
| INNs | Source |
|---|---|
| gimepiride | KEGG DRUG |
| glimepirida | WHO MedNet |
| glimépiride | WHO MedNet |
| glimepiridum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-{[4-(2-{[(3-ethyl-4-methyl-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)carbonyl]amino}ethyl)phenyl]sulfonyl}-3-(trans-4-methylcyclohexyl)urea | IUPAC |
| 1-((p-(2-(3-Ethyl-4-methyl-2-oxo-3-pyrroline-1-carboxamido)ethyl)phenyl)sulfonyl)-3-(trans-4-methylcyclohexyl)urea | ChemIDplus |
| HOE 490 | ChEMBL |
| HOE-490 | ChEMBL |
| NSC-759809 | ChEMBL |
| Brand Names | Source |
|---|---|
| Amaryl | KEGG DRUG |
| Glimepiride component of avandaryl | ChEMBL |
| Glimepiride component of duetact | ChEMBL |
| Niddaryl | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1300 | DrugCentral |
| C07669 | KEGG COMPOUND |
| D00593 | KEGG DRUG |
| DB00222 | DrugBank |
| HMDB0014367 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7731873 | Reaxys |
| CAS:93479-97-1 | KEGG COMPOUND |
| CAS:93479-97-1 | ChemIDplus |
| Citations |
|---|