EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N4O5S |
| Net Charge | 0 |
| Average Mass | 490.626 |
| Monoisotopic Mass | 490.22499 |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@H]3CC[C@H](C)CC3)cc2)C1=O |
| InChI | InChI=1S/C24H34N4O5S/c1-4-21-17(3)15-28(22(21)29)24(31)25-14-13-18-7-11-20(12-8-18)34(32,33)27-23(30)26-19-9-5-16(2)6-10-19/h7-8,11-12,16,19H,4-6,9-10,13-15H2,1-3H3,(H,25,31)(H2,26,27,30)/t16-,19- |
| InChIKey | WIGIZIANZCJQQY-RUCARUNLSA-N |
| Roles Classification |
|---|
| Biological Role: | insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glimepiride (CHEBI:5383) has role hypoglycemic agent (CHEBI:35526) |
| glimepiride (CHEBI:5383) has role insulin secretagogue (CHEBI:90415) |
| glimepiride (CHEBI:5383) is a N-acylurea (CHEBI:74266) |
| glimepiride (CHEBI:5383) is a N-sulfonylurea (CHEBI:76983) |
| glimepiride (CHEBI:5383) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-ethyl-4-methyl-N-[2-(4-{[(trans-4-methylcyclohexyl)carbamoyl]sulfamoyl}phenyl)ethyl]-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxamide |
| INNs | Source |
|---|---|
| gimepiride | KEGG DRUG |
| glimepirida | WHO MedNet |
| glimépiride | WHO MedNet |
| glimepiridum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-{[4-(2-{[(3-ethyl-4-methyl-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)carbonyl]amino}ethyl)phenyl]sulfonyl}-3-(trans-4-methylcyclohexyl)urea | IUPAC |
| 1-((p-(2-(3-Ethyl-4-methyl-2-oxo-3-pyrroline-1-carboxamido)ethyl)phenyl)sulfonyl)-3-(trans-4-methylcyclohexyl)urea | ChemIDplus |
| Brand Name | Source |
|---|---|
| Amaryl | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1300 | DrugCentral |
| C07669 | KEGG COMPOUND |
| D00593 | KEGG DRUG |
| DB00222 | DrugBank |
| HMDB0014367 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7731873 | Reaxys |
| CAS:93479-97-1 | KEGG COMPOUND |
| CAS:93479-97-1 | ChemIDplus |
| Citations |
|---|