EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c1O[C@H](c1ccccc1)[C@@H](O)C2=O |
| InChI | InChI=1S/C20H20O5/c1-11(2)8-9-13-14(21)10-15(22)16-17(23)18(24)19(25-20(13)16)12-6-4-3-5-7-12/h3-8,10,18-19,21-22,24H,9H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | ATJOIGKHVRPLSM-RBUKOAKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza lepidota (ncbitaxon:47080) | - | PubMed (11524125) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glepidotin B (CHEBI:5381) has functional parent (2S)-flavanone (CHEBI:15606) |
| glepidotin B (CHEBI:5381) has role plant metabolite (CHEBI:76924) |
| glepidotin B (CHEBI:5381) is a dihydroflavonols (CHEBI:48039) |
| glepidotin B (CHEBI:5381) is a secondary α-hydroxy ketone (CHEBI:2468) |
| glepidotin B (CHEBI:5381) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one |
| Citations |
|---|