EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H60O10 |
| Net Charge | 0 |
| Average Mass | 616.833 |
| Monoisotopic Mass | 616.41865 |
| SMILES | CCCCCCCCCc1ccc(OCCOCCOCCOCCOCCOCCOCCOCCOCCO)cc1 |
| InChI | InChI=1S/C33H60O10/c1-2-3-4-5-6-7-8-9-32-10-12-33(13-11-32)43-31-30-42-29-28-41-27-26-40-25-24-39-23-22-38-21-20-37-19-18-36-17-16-35-15-14-34/h10-13,34H,2-9,14-31H2,1H3 |
| InChIKey | FBWNMEQMRUMQSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | nonionic surfactant A surfactant with an uncharged hydrophilic headgroup. nonionic surfactant A surfactant with an uncharged hydrophilic headgroup. |
| Application: | contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tergitol NP-9 (CHEBI:53775) has role contraceptive drug (CHEBI:49323) |
| tergitol NP-9 (CHEBI:53775) has role nonionic surfactant (CHEBI:38828) |
| tergitol NP-9 (CHEBI:53775) is a tergitol (CHEBI:53774) |
| IUPAC Name |
|---|
| 26-(4-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol |
| Synonyms | Source |
|---|---|
| Tergitol NP9 | SUBMITTER |
| Nonoxynol 9 | KEGG DRUG |
| p-Nonylphenyl polyethylene glycol ether | KEGG DRUG |
| PEG-9 Nonyl phenyl ether | ChemIDplus |
| 26-(Nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | ChemIDplus |
| Polyoxyethylene (9) nonyl phenyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D06490 | KEGG DRUG |
| Nonoxynol-9 | Wikipedia |
| LSM-3971 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2031786 | Beilstein |