EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H66O14 |
| Net Charge | 0 |
| Average Mass | 806.987 |
| Monoisotopic Mass | 806.44526 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O[C@H]1C[C@H](O)[C@H](O[C@H]3C[C@H](O)[C@H](O[C@H]4C[C@H](OC(C)=O)[C@H](O)[C@@H](C)O4)[C@@H](C)O3)[C@@H](C)O1)C2 |
| InChI | InChI=1S/C43H66O14/c1-21-38(48)33(54-24(4)44)19-37(51-21)57-40-23(3)53-36(18-32(40)46)56-39-22(2)52-35(17-31(39)45)55-27-9-12-41(5)26(16-27)7-8-30-29(41)10-13-42(6)28(11-14-43(30,42)49)25-15-34(47)50-20-25/h15,21-23,26-33,35-40,45-46,48-49H,7-14,16-20H2,1-6H3/t21-,22-,23-,26-,27+,28-,29+,30-,31+,32+,33+,35+,36+,37+,38-,39-,40-,41+,42-,43+/m1/s1 |
| InChIKey | HPMZBILYSWLILX-UMDUKNJSSA-N |
| Roles Classification |
|---|
| Biological Role: | enzyme inhibitor A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'''-O-acetyldigitoxin (CHEBI:53773) has functional parent digitoxin (CHEBI:28544) |
| 3'''-O-acetyldigitoxin (CHEBI:53773) has role anti-arrhythmia drug (CHEBI:38070) |
| 3'''-O-acetyldigitoxin (CHEBI:53773) has role cardiotonic drug (CHEBI:38147) |
| 3'''-O-acetyldigitoxin (CHEBI:53773) has role enzyme inhibitor (CHEBI:23924) |
| 3'''-O-acetyldigitoxin (CHEBI:53773) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 3β-[3-O-acetyl-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyloxy]-14-hydroxy-5β-card-20(22)-enolide |
| INNs | Source |
|---|---|
| acetildigitoxina | ChemIDplus |
| acetyldigitoxin | KEGG DRUG |
| acetyldigitoxinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Acetyldiginatin | KEGG GLYCAN |
| Acetyl-digitoxin-alpha | ChemIDplus |
| Acetylgitaloxin | KEGG GLYCAN |
| Acetylgitoxin | KEGG GLYCAN |
| alpha-Acetyldigitoxin | ChemIDplus |
| alpha-Acetylgitaloxin | KEGG COMPOUND |
| Citations |
|---|