EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15NO6 |
| Net Charge | 0 |
| Average Mass | 353.330 |
| Monoisotopic Mass | 353.08994 |
| SMILES | CC(=O)C[C@H](c1ccc([N+](=O)[O-])cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3/t15-/m1/s1 |
| InChIKey | VABCILAOYCMVPS-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor An EC 1.6.5.* (oxidoreductase acting on NADH or NADPH with a quinone or similar as acceptor) inhibitor that interferes with the action of NAD(P)H dehydrogenase (quinone), EC 1.6.5.2. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anticoagulant An agent that prevents blood clotting. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-acenocoumarol (CHEBI:53768) is a acenocoumarol (CHEBI:53766) |
| (R)-acenocoumarol (CHEBI:53768) is enantiomer of (S)-acenocoumarol (CHEBI:53769) |
| Incoming Relation(s) |
| (S)-acenocoumarol (CHEBI:53769) is enantiomer of (R)-acenocoumarol (CHEBI:53768) |
| IUPAC Name |
|---|
| 4-hydroxy-3-[(1R)-1-(4-nitrophenyl)-3-oxobutyl]-2H-chromen-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300221 | Reaxys |
| CAS:66556-77-2 | ChemIDplus |