EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53767 - chloramine T
| Formula | C7H7ClNO2S.Na |
| Net Charge | 0 |
| Average Mass | 227.648 |
| Monoisotopic Mass | 226.97837 |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+] |
| InChI | InChI=1S/C7H7ClNO2S.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;/h2-5H,1H3;/q-1;+1 |
| InChIKey | VDQQXEISLMTGAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloramine T (CHEBI:53767) has part chloro(p-tolylsulfonyl)azanide (CHEBI:53787) |
| chloramine T (CHEBI:53767) has role allergen (CHEBI:50904) |
| chloramine T (CHEBI:53767) has role antifouling biocide (CHEBI:51076) |
| chloramine T (CHEBI:53767) has role disinfectant (CHEBI:48219) |
| chloramine T (CHEBI:53767) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium chloro[(4-methylphenyl)sulfonyl]azanide |
| INN | Source |
|---|---|
| Tosylchloramide sodium | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Acti-chlore | ChemIDplus |
| Chloralone | ChemIDplus |
| Chloramine-t | NIST Chemistry WebBook |
| Chloramine-T | ChemIDplus |
| Chlorasan | ChemIDplus |
| Chloraseptine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Chloramine_T | Wikipedia |
| D02445 | KEGG DRUG |
| Citations |
|---|