EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7ClNO2S.Na |
| Net Charge | 0 |
| Average Mass | 227.648 |
| Monoisotopic Mass | 226.97837 |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+] |
| InChI | InChI=1S/C7H7ClNO2S.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;/h2-5H,1H3;/q-1;+1 |
| InChIKey | VDQQXEISLMTGAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloramine T (CHEBI:53767) has part chloro(p-tolylsulfonyl)azanide (CHEBI:53787) |
| chloramine T (CHEBI:53767) has role allergen (CHEBI:50904) |
| chloramine T (CHEBI:53767) has role antifouling biocide (CHEBI:51076) |
| chloramine T (CHEBI:53767) has role disinfectant (CHEBI:48219) |
| chloramine T (CHEBI:53767) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium chloro[(4-methylphenyl)sulfonyl]azanide |
| INN | Source |
|---|---|
| Tosylchloramide sodium | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Acti-chlore | ChemIDplus |
| Chloralone | ChemIDplus |
| Chloramine-t | NIST Chemistry WebBook |
| Chloramine-T | ChemIDplus |
| Chlorasan | ChemIDplus |
| Chloraseptine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Chloramine_T | Wikipedia |
| D02445 | KEGG DRUG |
| Citations |
|---|