EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2OS |
| Net Charge | 0 |
| Average Mass | 356.535 |
| Monoisotopic Mass | 356.19223 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2cccs2)C[C@@H]1C |
| InChI | InChI=1S/C21H28N2OS/c1-3-21(24)23(18-8-5-4-6-9-18)20-12-14-22(16-17(20)2)13-11-19-10-7-15-25-19/h4-10,15,17,20H,3,11-14,16H2,1-2H3/t17-,20?/m0/s1 |
| InChIKey | SRARDYUHGVMEQI-DIMJTDRSSA-N |
| Roles Classification |
|---|
| Biological Role: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-methylthiofentanyl (CHEBI:53765) is a 3-methylthiofentanyl (CHEBI:53763) |
| (3S)-methylthiofentanyl (CHEBI:53765) is enantiomer of (3R)-methylthiofentanyl (CHEBI:53764) |
| Incoming Relation(s) |
| (3R)-methylthiofentanyl (CHEBI:53764) is enantiomer of (3S)-methylthiofentanyl (CHEBI:53765) |
| IUPAC Name |
|---|
| N-{(3S)-3-methyl-1-[2-(2-thienyl)ethyl]piperidin-4-yl}-N-phenylpropanamide |
| Manual Xrefs | Databases |
|---|---|
| DB01439 | DrugBank |