EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO3 |
| Net Charge | 0 |
| Average Mass | 297.354 |
| Monoisotopic Mass | 297.13649 |
| SMILES | [H][C@@]12CC3(C=CC(=O)C=C3)c3c(O)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C18H19NO3/c1-19-8-5-11-9-14(22-2)17(21)16-15(11)13(19)10-18(16)6-3-12(20)4-7-18/h3-4,6-7,9,13,21H,5,8,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | PNJUPRNTSWJWAX-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glaziovine (CHEBI:5376) is a alkaloid (CHEBI:22315) |
| INN | Source |
|---|---|
| glaziovina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Glaziovine | KEGG COMPOUND |
| NSC-146052 | ChEMBL |
| Citations |
|---|