EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H104O6 |
| Net Charge | 0 |
| Average Mass | 885.453 |
| Monoisotopic Mass | 884.78329 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
| InChIKey | PHYFQTYBJUILEZ-IUPFWZBJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23475189) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triolein (CHEBI:53753) has functional parent oleic acid (CHEBI:16196) |
| triolein (CHEBI:53753) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| triolein (CHEBI:53753) has role plant metabolite (CHEBI:76924) |
| triolein (CHEBI:53753) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl tris[(9Z)-octadec-9-enoate] |
| Synonyms | Source |
|---|---|
| Glyceryl trioleate | ChemIDplus |
| Glycerin trioleate | ChemIDplus |
| Glycerol trioleate | ChemIDplus |
| Glycerol triolein | ChemIDplus |
| Glycerol, tri(cis-9-octadecenoate) | ChemIDplus |
| Glyceryl-1,2,3-trioleate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,2,3-tri-(9Z-octadecenoyl)-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMGL03010250 | LIPID MAPS |
| CPD-11691 | MetaCyc |
| Triolein | Wikipedia |
| HMDB0005453 | HMDB |
| 491 | PPDB |
| Citations |
|---|