EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO3 |
| Net Charge | 0 |
| Average Mass | 117.104 |
| Monoisotopic Mass | 117.04259 |
| SMILES | [H]C(=O)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H7NO3/c5-3(1-2-6)4(7)8/h2-3H,1,5H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | HOSWPDPVFBCLSY-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-aspartic acid 4-semialdehyde zwitterion (CHEBI:537519) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-aspartic acid 4-semialdehyde zwitterion (CHEBI:537519) is tautomer of L-aspartic 4-semialdehyde (CHEBI:18051) |
| Incoming Relation(s) |
| L-aspartic 4-semialdehyde (CHEBI:18051) is tautomer of L-aspartic acid 4-semialdehyde zwitterion (CHEBI:537519) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-4-oxobutanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-azaniumyl-4-oxobutanoate | IUPAC |
| aspartate semi-aldehyde | ChEMBL |
| aspartate β-semialdehyde | ChEBI |
| L-2-ammonio-4-oxobutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-aspartate 4-semialdehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| AS2 | PDBeChem |
| Citations |
|---|