EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2O5 |
| Net Charge | 0 |
| Average Mass | 262.221 |
| Monoisotopic Mass | 262.05897 |
| SMILES | [H]C(OCC)=C1N=C(c2ccc([N+](=O)[O-])cc2)OC1=O |
| InChI | InChI=1S/C12H10N2O5/c1-2-18-7-10-12(15)19-11(13-10)8-3-5-9(6-4-8)14(16)17/h3-7H,2H2,1H3 |
| InChIKey | ZMARVJHNAZOGEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(p-nitrophenyl)-4-ethoxymethyleneoxazol-5-one (CHEBI:53744) has role hapten (CHEBI:59174) |
| 2-(p-nitrophenyl)-4-ethoxymethyleneoxazol-5-one (CHEBI:53744) is a 1,3-oxazoles (CHEBI:46812) |
| 2-(p-nitrophenyl)-4-ethoxymethyleneoxazol-5-one (CHEBI:53744) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 4-(ethoxymethylidene)-2-(4-nitrophenyl)-1,3-oxazol-5(4H)-one |
| Synonyms | Source |
|---|---|
| 4-ethoxymethylene-2-(4-nitrophenyl)-4-oxazol-5-one | ChEBI |
| NO2-phOx | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:272912 | Reaxys |
| Citations |
|---|