EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5371 - glaucarubinone
| Formula | C25H34O10 |
| Net Charge | 0 |
| Average Mass | 494.537 |
| Monoisotopic Mass | 494.21520 |
| SMILES | [H][C@@]12[C@@H](OC(=O)[C@@](C)(O)CC)C(=O)O[C@]3([H])C[C@@]4([H])C(C)=CC(=O)[C@@H](O)[C@]4(C)[C@]4([H])[C@]13CO[C@@]4(O)[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C25H34O10/c1-6-22(4,31)21(30)35-16-15-11(3)17(27)25(32)20-23(5)12(10(2)7-13(26)18(23)28)8-14(34-19(16)29)24(15,20)9-33-25/h7,11-12,14-18,20,27-28,31-32H,6,8-9H2,1-5H3/t11-,12+,14-,15-,16-,17-,18-,20-,22+,23-,24+,25+/m1/s1 |
| InChIKey | WRBGCYVAJRRQKP-STDAJNJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simarouba versicolor (ncbitaxon:459157) | |||
| - | PubMed (895397) | ||
| bark (BTO:0001301) | PubMed (19501276) | Isolated form root bark. | |
| Simarouba glauca (ncbitaxon:43729) | Root (BTO:0001188) | PubMed (26178388) | |
| Ailanthus altissimus (ncbitaxon:2768810) | - | PubMed (29953225) | Isolated from the samara. |
| Nothospondias staudtii (ncbitaxon:459131) | - | PubMed (21733691) | |
| Ailanthus excelsus (ncbitaxon:1133704) | |||
| bark (BTO:0001301) | PubMed (600027) | Isolated form root bark. | |
| bark (BTO:0001301) | PubMed (12560029) | Isolated from stem bark. | |
| Odyendyea gabonensis (ncbitaxon:459133) | bark (BTO:0001301) | PubMed (17340307) | Isolated from stem bark. |
| Simarouba amara (ncbitaxon:101569) | - | PubMed (720499) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glaucarubinone (CHEBI:5371) has role antimalarial (CHEBI:38068) |
| glaucarubinone (CHEBI:5371) has role antineoplastic agent (CHEBI:35610) |
| glaucarubinone (CHEBI:5371) has role geroprotector (CHEBI:176497) |
| glaucarubinone (CHEBI:5371) has role plant metabolite (CHEBI:76924) |
| glaucarubinone (CHEBI:5371) is a carboxylic ester (CHEBI:33308) |
| glaucarubinone (CHEBI:5371) is a organic heteropentacyclic compound (CHEBI:38164) |
| glaucarubinone (CHEBI:5371) is a quassinoid (CHEBI:72485) |
| glaucarubinone (CHEBI:5371) is a secondary α-hydroxy ketone (CHEBI:2468) |
| glaucarubinone (CHEBI:5371) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| glaucarubinone (CHEBI:5371) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 1β,11α,12α-trihydroxy-2,16-dioxo-11,20-epoxypicras-3-en-15β-yl (2S)-2-hydroxy-2-methylbutanoate |
| Synonym | Source |
|---|---|
| (+)-glaucarubinone | ChEBI |
| Citations |
|---|