EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N2O4S |
| Net Charge | 0 |
| Average Mass | 333.389 |
| Monoisotopic Mass | 333.09090 |
| SMILES | *C(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)COc3ccccc3)[C@@]2([H])SC1(C)C |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenoxymethylpenicillanyl group (CHEBI:53706) has role antibacterial agent (CHEBI:33282) |
| phenoxymethylpenicillanyl group (CHEBI:53706) is a organyl group (CHEBI:33249) |
| phenoxymethylpenicillanyl group (CHEBI:53706) is a penicilloyl group allergen (CHEBI:88223) |
| phenoxymethylpenicillanyl group (CHEBI:53706) is substituent group from phenoxymethylpenicillin (CHEBI:27446) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(phenoxyacetyl)amino]penam-3α-carbonyl |
| Synonyms | Source |
|---|---|
| phenoxomethylpenicillanyl | ChEBI |
| PVA | ChEBI |
| phenoxymethylpenicillanyl | ChEBI |
| {(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]hept-2-yl}carbonyl | IUPAC |
| Citations |
|---|