EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O5S |
| Net Charge | 0 |
| Average Mass | 351.404 |
| Monoisotopic Mass | 351.10147 |
| SMILES | *C(=O)[C@@H](NC(=O)COc1ccccc1)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenoxymethylpenicilloyl group (CHEBI:53703) has role antibacterial agent (CHEBI:33282) |
| phenoxymethylpenicilloyl group (CHEBI:53703) is a penicilloyl group (CHEBI:88224) |
| phenoxymethylpenicilloyl group (CHEBI:53703) is a penicilloyl group allergen (CHEBI:88223) |
| phenoxymethylpenicilloyl group (CHEBI:53703) is a univalent carboacyl group (CHEBI:27207) |
| phenoxymethylpenicilloyl group (CHEBI:53703) is substituent group from phenoxymethylpenicillin (CHEBI:27446) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,4S)-4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl]-2-[(phenoxyacetyl)amino]acetyl |
| Synonyms | Source |
|---|---|
| phenoxymethylpenicilloyl | ChEBI |
| PVO | ChEBI |
| phenoxomethylpenicilloyl | ChEBI |
| penicilloyl V | ChEBI |
| Citations |
|---|