EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16AsN3O6 |
| Net Charge | 0 |
| Average Mass | 409.230 |
| Monoisotopic Mass | 409.02551 |
| SMILES | N[C@@H](Cc1ccc(O)c(/N=N/c2ccc([As](=O)(O)O)cc2)c1)C(=O)O |
| InChI | InChI=1S/C15H16AsN3O6/c17-12(15(21)22)7-9-1-6-14(20)13(8-9)19-18-11-4-2-10(3-5-11)16(23,24)25/h1-6,8,12,20H,7,17H2,(H,21,22)(H2,23,24,25)/b19-18+/t12-/m0/s1 |
| InChIKey | RTPAIUXEQXVJCO-RUWSDDDDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrosine-4-azobenzenearsonate (CHEBI:53697) has functional parent arsanilic acid (CHEBI:49477) |
| tyrosine-4-azobenzenearsonate (CHEBI:53697) is a L-tyrosine derivative (CHEBI:27177) |
| tyrosine-4-azobenzenearsonate (CHEBI:53697) is a monoazo compound (CHEBI:48959) |
| tyrosine-4-azobenzenearsonate (CHEBI:53697) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3-[(4-arsonophenyl)diazenyl]-L-tyrosine |
| Synonyms | Source |
|---|---|
| ABA-T | ChemIDplus |
| ABA-Tyr | ChEBI |
| Arsanilazotyrosine | ChemIDplus |
| Azobenzenarsonate-tyrosine | ChemIDplus |
| p-azobenzenearsonate-L-tyrosine | ChEBI |
| L-Tyrosine-4-azobenzenearsonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:33650-94-1 | ChemIDplus |
| Citations |
|---|