EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8IN3O2 |
| Net Charge | 0 |
| Average Mass | 281.053 |
| Monoisotopic Mass | 280.96612 |
| SMILES | N[C@@H](Cc1ncnc1I)C(=O)O |
| InChI | InChI=1S/C6H8IN3O2/c7-5-4(9-2-10-5)1-3(8)6(11)12/h2-3H,1,8H2,(H,9,10)(H,11,12)/t3-/m0/s1 |
| InChIKey | AAKROHZJMPGWQF-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-iodo-L-histidine (CHEBI:53694) is a L-histidine derivative (CHEBI:84076) |
| 5-iodo-L-histidine (CHEBI:53694) is a iodoamino acid (CHEBI:24862) |
| 5-iodo-L-histidine (CHEBI:53694) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 5-iodo-L-histidine |
| Synonyms | Source |
|---|---|
| 5-iodohistidine | ChEBI |
| 5-Iodo-L-histidine | ChemIDplus |
| monoiodohistidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10316 | Beilstein |
| CAS:40649-71-6 | ChemIDplus |
| Citations |
|---|