EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7I2N3O2 |
| Net Charge | 0 |
| Average Mass | 406.949 |
| Monoisotopic Mass | 406.86277 |
| SMILES | N[C@@H](Cc1nc(I)nc1I)C(=O)O |
| InChI | InChI=1S/C6H7I2N3O2/c7-4-3(10-6(8)11-4)1-2(9)5(12)13/h2H,1,9H2,(H,10,11)(H,12,13)/t2-/m0/s1 |
| InChIKey | ZMELUTBTYDGWOF-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-diiodo-L-histidine (CHEBI:53693) is a L-histidine derivative (CHEBI:84076) |
| 2,5-diiodo-L-histidine (CHEBI:53693) is a iodoamino acid (CHEBI:24862) |
| 2,5-diiodo-L-histidine (CHEBI:53693) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 2,5-diiodo-L-histidine |
| Synonyms | Source |
|---|---|
| 2,4-diiodohistidine | ChEBI |
| 2,4-diiodo-L-histidine | ChEBI |
| diiodohistidine | ChEBI |
| 2,5-diiodohistidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6599014 | Reaxys |
| Reaxys:15249 | Reaxys |
| Citations |
|---|