EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9I3N2O4 |
| Net Charge | 0 |
| Average Mass | 613.915 |
| Monoisotopic Mass | 613.76965 |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | YVPYQUNUQOZFHG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amidotrizoic acid (CHEBI:53691) has role environmental contaminant (CHEBI:78298) |
| amidotrizoic acid (CHEBI:53691) has role radioopaque medium (CHEBI:37338) |
| amidotrizoic acid (CHEBI:53691) has role xenobiotic (CHEBI:35703) |
| amidotrizoic acid (CHEBI:53691) is a acetamides (CHEBI:22160) |
| amidotrizoic acid (CHEBI:53691) is a benzoic acids (CHEBI:22723) |
| amidotrizoic acid (CHEBI:53691) is a organoiodine compound (CHEBI:37142) |
| amidotrizoic acid (CHEBI:53691) is conjugate acid of amidotrizoic acid anion (CHEBI:59731) |
| Incoming Relation(s) |
| amidotrizoic acid dihydrate (CHEBI:59733) has part amidotrizoic acid (CHEBI:53691) |
| amidotrizoic acid anion (CHEBI:59731) is conjugate base of amidotrizoic acid (CHEBI:53691) |
| IUPAC Name |
|---|
| 3,5-diacetamido-2,4,6-triiodobenzoic acid |
| Synonyms | Source |
|---|---|
| 2,4,6-Triiodo-3,5-diacetamidobenzoic acid | ChemIDplus |
| 3,5-Bis(acetylamino)-2,4,6-triiodobenzoic acid | ChemIDplus |
| Acide amidotrizoique | ChemIDplus |
| Acidum amidotrizoicum | ChEBI |
| Acidum diacetylaminotrijodbenzoicum | ChEBI |
| Amidotrizoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 851 | DrugCentral |
| D02240 | KEGG DRUG |
| DB00271 | DrugBank |
| Diatrizoic_acid | Wikipedia |
| HMDB0014416 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2225144 | Reaxys |
| CAS:117-96-4 | KEGG DRUG |
| CAS:117-96-4 | ChemIDplus |
| CAS:117-96-4 | DrugBank |
| Citations |
|---|