EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC1(C)C=Cc2c(ccc3c2OC[C@@H](c2ccc(O)cc2O)C3)O1 |
| InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | LBQIJVLKGVZRIW-ZDUSSCGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glabridin (CHEBI:5369) has parent hydride (R)-isoflavan (CHEBI:36101) |
| glabridin (CHEBI:5369) has role antiplasmodial drug (CHEBI:64915) |
| glabridin (CHEBI:5369) is a hydroxyisoflavans (CHEBI:76250) |
| IUPAC Name |
|---|
| 4-[(3R)-8,8-dimethyl-3,4-dihydro-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]benzene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| C00002529 | KNApSAcK |
| C10421 | KEGG COMPOUND |
| Glabridin | Wikipedia |
| HMDB0034188 | HMDB |
| LMPK12080012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7141956 | Reaxys |
| CAS:59870-68-7 | KEGG COMPOUND |
| CAS:59870-68-7 | ChemIDplus |
| Citations |
|---|