EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c1O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C20H20O4/c1-12(2)8-9-14-15(21)10-16(22)19-17(23)11-18(24-20(14)19)13-6-4-3-5-7-13/h3-8,10,18,21-22H,9,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | DAWSYIQAGQMLFS-SFHVURJKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glabranin (CHEBI:5368) has functional parent pinocembrin (CHEBI:28157) |
| glabranin (CHEBI:5368) has role plant metabolite (CHEBI:76924) |
| glabranin (CHEBI:5368) is a (2S)-flavan-4-one (CHEBI:140377) |
| glabranin (CHEBI:5368) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-6-prenylflavanone | ChEBI |
| 8-dimethylallylpinocembrin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09752 | KEGG COMPOUND |
| C00000965 | KNApSAcK |
| WO2012004228 | Patent |
| LMPK12140164 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6573429 | Reaxys |
| CAS:41983-91-9 | KEGG COMPOUND |
| CAS:41983-91-9 | ChemIDplus |
| Citations |
|---|