EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H56N10 |
| Net Charge | 0 |
| Average Mass | 508.804 |
| Monoisotopic Mass | 508.46894 |
| SMILES | CCCCC(CC)CNC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)NCC(CC)CCCC |
| InChI | InChI=1S/C26H56N10/c1-5-9-15-21(7-3)19-33-25(29)35-23(27)31-17-13-11-12-14-18-32-24(28)36-26(30)34-20-22(8-4)16-10-6-2/h21-22H,5-20H2,1-4H3,(H5,27,29,31,33,35)(H5,28,30,32,34,36) |
| InChIKey | LFVVNPBBFUSSHL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alexidine (CHEBI:53661) has role antibacterial agent (CHEBI:33282) |
| alexidine (CHEBI:53661) is a biguanides (CHEBI:53662) |
| IUPAC Name |
|---|
| N,N''''-hexane-1,6-diylbis[N'-(2-ethylhexyl)(imidodicarbonimidic diamide)] |
| INNs | Source |
|---|---|
| alexidina | ChemIDplus |
| alexidine | ChemIDplus |
| alexidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,1'-Hexamethylenebis(5-(2-ethylhexyl)biguanide) | ChemIDplus |
| bisguadine | ChEBI |
| N,N'-bis(2-ethylhexyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 113 | DrugCentral |
| Alexidine | Wikipedia |
| CN101624356 | Patent |
| LSM-4432 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2404807 | Reaxys |
| CAS:22573-93-9 | ChemIDplus |
| Citations |
|---|