EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N4O6 |
| Net Charge | 0 |
| Average Mass | 326.309 |
| Monoisotopic Mass | 326.12263 |
| SMILES | NCCCCCCNc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N4O6/c14-5-3-1-2-4-6-15-12-10(13(18)19)7-9(16(20)21)8-11(12)17(22)23/h7-8,15H,1-6,14H2,(H,18,19) |
| InChIKey | PEGSMPHAYGPKIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,4-dinitro-6-carboxy)phenyl-1.6-diaminohexane (CHEBI:53649) has functional parent hexane-1,6-diamine (CHEBI:39618) |
| N-(2,4-dinitro-6-carboxy)phenyl-1.6-diaminohexane (CHEBI:53649) is a C-nitro compound (CHEBI:35716) |
| N-(2,4-dinitro-6-carboxy)phenyl-1.6-diaminohexane (CHEBI:53649) is a N-substituted diamine (CHEBI:50441) |
| N-(2,4-dinitro-6-carboxy)phenyl-1.6-diaminohexane (CHEBI:53649) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-[(6-aminohexyl)amino]-3,5-dinitrobenzoic acid |
| Synonym | Source |
|---|---|
| o-DNCP-HEX-NH2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6534043 | Beilstein |
| Citations |
|---|