EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46N6O13 |
| Net Charge | 0 |
| Average Mass | 614.650 |
| Monoisotopic Mass | 614.31229 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O[C@H]4O[C@H](CN)[C@@H](O)[C@H](O)[C@H]4N)[C@H]3O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | PGBHMTALBVVCIT-VZXHOKRSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neomycin C (CHEBI:53634) is a aminoglycoside (CHEBI:47779) |
| neomycin C (CHEBI:53634) is conjugate base of neomycin C(6+) (CHEBI:65077) |
| Incoming Relation(s) |
| neomycin (CHEBI:7507) has part neomycin C (CHEBI:53634) |
| neomycin C sulfate (CHEBI:53637) has part neomycin C (CHEBI:53634) |
| neomycin C(6+) (CHEBI:65077) is conjugate acid of neomycin C (CHEBI:53634) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside |
| Citations |
|---|