EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O2 |
| Net Charge | 0 |
| Average Mass | 269.304 |
| Monoisotopic Mass | 269.11643 |
| SMILES | CC(=O)Nc1ccc(/N=N/c2cc(C)ccc2O)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-3-8-15(20)14(9-10)18-17-13-6-4-12(5-7-13)16-11(2)19/h3-9,20H,1-2H3,(H,16,19)/b18-17+ |
| InChIKey | PXOZAFXVEWKXED-ISLYRVAYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-hydroxy-5-methylphenylazo)acetanilide (CHEBI:53617) has functional parent azobenzene (CHEBI:190358) |
| 4-(2-hydroxy-5-methylphenylazo)acetanilide (CHEBI:53617) has role allergen (CHEBI:50904) |
| 4-(2-hydroxy-5-methylphenylazo)acetanilide (CHEBI:53617) has role dye (CHEBI:37958) |
| 4-(2-hydroxy-5-methylphenylazo)acetanilide (CHEBI:53617) is a azobenzenes (CHEBI:22682) |
| 4-(2-hydroxy-5-methylphenylazo)acetanilide (CHEBI:53617) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-{4-[(E)-(2-hydroxy-5-methylphenyl)diazenyl]phenyl}acetamide |
| Synonyms | Source |
|---|---|
| Disperse Yellow 3 | ChemIDplus |
| 4-Acetamido-2'-hydroxy-5'-methylazobenzene | ChemIDplus |
| 4'-((6-Hydroxy-m-tolyl)azo)acetanilide | ChemIDplus |
| N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]-acetamide | KEGG COMPOUND |
| Citations |
|---|