EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N4 |
| Net Charge | 0 |
| Average Mass | 212.256 |
| Monoisotopic Mass | 212.10620 |
| SMILES | Nc1ccc(/N=N/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N4/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2/b16-15+ |
| InChIKey | KQIKKETXZQDHGE-FOCLMDBBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-diaminoazobenzene (CHEBI:53616) has functional parent azobenzene (CHEBI:190358) |
| 4,4'-diaminoazobenzene (CHEBI:53616) has role carcinogenic agent (CHEBI:50903) |
| 4,4'-diaminoazobenzene (CHEBI:53616) is a azobenzenes (CHEBI:22682) |
| 4,4'-diaminoazobenzene (CHEBI:53616) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 4,4'-(E)-diazene-1,2-diyldianiline |
| Synonyms | Source |
|---|---|
| 4,4'-Azobisbenzenamine | ChemIDplus |
| 4,4'-Azodianiline | ChemIDplus |
| p'-Amino-p-aminoazobenzene | ChemIDplus |
| p-Azoaniline | ChemIDplus |
| p-Diaminoazobenzene | ChemIDplus |
| 4,4'-diazenediylbisaniline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:745553 | Reaxys |
| CAS:538-41-0 | ChemIDplus |
| Citations |
|---|