EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2 |
| Net Charge | 0 |
| Average Mass | 136.198 |
| Monoisotopic Mass | 136.10005 |
| SMILES | Cc1cc(N)c(C)cc1N |
| InChI | InChI=1S/C8H12N2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,9-10H2,1-2H3 |
| InChIKey | BWAPJIHJXDYDPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dimethyl-p-phenylenediamine (CHEBI:53613) has parent hydride p-xylene (CHEBI:27417) |
| 2,5-dimethyl-p-phenylenediamine (CHEBI:53613) has role allergen (CHEBI:50904) |
| 2,5-dimethyl-p-phenylenediamine (CHEBI:53613) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 2,5-dimethylbenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| 4-Amino-2,5-dimethylaniline | ChemIDplus |
| 1,4-dimethylphenylene-2,5-diamine | ChEBI |
| 2,5-dimethylphenylene-1,4-diamine | ChEBI |
| 2,5-dimethyl-1,4-benzoquinonediamine | ChEBI |
| 2,5-dimethyl-para-phenylenediamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2802422 | Reaxys |
| CAS:6393-01-7 | ChemIDplus |
| Citations |
|---|