EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53608 - O-(N-acetyl-α-D-galactosaminyl)-L-serine
| Formula | C11H20N2O8 |
| Net Charge | 0 |
| Average Mass | 308.287 |
| Monoisotopic Mass | 308.12197 |
| SMILES | CC(=O)N[C@H]1[C@@H](OC[C@H](N)C(=O)O)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N2O8/c1-4(15)13-7-9(17)8(16)6(2-14)21-11(7)20-3-5(12)10(18)19/h5-9,11,14,16-17H,2-3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6+,7+,8-,9+,11-/m0/s1 |
| InChIKey | REDMNGDGDYFZRE-WKWISIMFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | tumour antigen An antigenic substance produced in tumour cells, which triggers an immune response in the host. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(N-acetyl-α-D-galactosaminyl)-L-serine (CHEBI:53608) has role tumour antigen (CHEBI:144829) |
| O-(N-acetyl-α-D-galactosaminyl)-L-serine (CHEBI:53608) is a L-serine derivative (CHEBI:84135) |
| O-(N-acetyl-α-D-galactosaminyl)-L-serine (CHEBI:53608) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| O-(N-acetyl-α-D-galactosaminyl)-L-serine residue (CHEBI:53604) is substituent group from O-(N-acetyl-α-D-galactosaminyl)-L-serine (CHEBI:53608) |
| O-(N-acetyl-α-D-glucosaminyl)-L-serine residue (CHEBI:143279) is substituent group from O-(N-acetyl-α-D-galactosaminyl)-L-serine (CHEBI:53608) |
| IUPAC Name |
|---|
| O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-L-serine |
| Synonyms | Source |
|---|---|
| GalNAc(α1→O)Ser | JCBN |
| GalNAcα1-Ser | ChEBI |
| α-D-GalNAc-Ser | ChEBI |
| O-(N-acetyl-α-D-galactosaminyl)-L-serine | ChEBI |
| O-[2-(acetylamino)-2-deoxy-α-D-galactopyranosyl]-L-serine | ChEBI |
| GalNac-α-1-O-serine | ChEBI |
| Citations |
|---|