EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O14 |
| Net Charge | 0 |
| Average Mass | 801.024 |
| Monoisotopic Mass | 800.49221 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,52)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(46)38(3,4)35(39)23(17-41(26,40)7)53-37-34(32(50)30(48)25(19-44)55-37)56-36-33(51)31(49)29(47)24(18-43)54-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36-,37+,39+,40+,41+,42-/m0/s1 |
| InChIKey | UZIOUZHBUYLDHW-XUBRWZAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Rf (CHEBI:67986) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Rf (CHEBI:67986) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside Rf (CHEBI:67986) has role apoptosis inducer (CHEBI:68495) |
| ginsenoside Rf (CHEBI:67986) has role plant metabolite (CHEBI:76924) |
| ginsenoside Rf (CHEBI:67986) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside Rf (CHEBI:67986) is a 20-hydroxy steroid (CHEBI:36854) |
| ginsenoside Rf (CHEBI:67986) is a 3β-hydroxy steroid (CHEBI:36836) |
| ginsenoside Rf (CHEBI:67986) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| ginsenoside Rf (CHEBI:67986) is a disaccharide derivative (CHEBI:63353) |
| ginsenoside Rf (CHEBI:67986) is a ginsenoside (CHEBI:74978) |
| ginsenoside Rf (CHEBI:67986) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Rf (CHEBI:67986) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (β,6α,12β)-3,12,20-trihydroxydammar-24-en-6-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Panaxoside RF | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08945 | KEGG COMPOUND |
| US2007224297 | Patent |
| HMDB0034745 | HMDB |
| CPD-15441 | MetaCyc |
| C00003519 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5721199 | Reaxys |
| CAS:52286-58-5 | KEGG COMPOUND |
| CAS:52286-58-5 | ChemIDplus |
| Citations |
|---|